C15H8F3N3O — CID 82196544
5-(3,4-difluorophenyl)-1-(2-fluorophenyl)triazole-4-carbaldehyde (PubChem CID 82196544) has the molecular formula C15H8F3N3O and a molecular weight of 303.24 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-1-(2-fluorophenyl)triazole-4-carbaldehyde.
| Compound Name | 5-(3,4-difluorophenyl)-1-(2-fluorophenyl)triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 82196544 |
| Molecular Formula | C15H8F3N3O |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 5-(3,4-difluorophenyl)-1-(2-fluorophenyl)triazole-4-carbaldehyde |
| SMILES | O=Cc1nnn(-c2ccccc2F)c1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H8F3N3O/c16-10-6-5-9(7-12(10)18)15-13(8-22)19-20-21(15)14-4-2-1-3-11(14)17/h1-8H |
| InChIKey | PWSYBTCJFFJAQO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|