C17H13F2N3O — CID 94938666
5-(3,4-difluorophenyl)-1-(3,5-dimethylphenyl)triazole-4-carbaldehyde (PubChem CID 94938666) has the molecular formula C17H13F2N3O and a molecular weight of 313.31 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-1-(3,5-dimethylphenyl)triazole-4-carbaldehyde.
| Compound Name | 5-(3,4-difluorophenyl)-1-(3,5-dimethylphenyl)triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 94938666 |
| Molecular Formula | C17H13F2N3O |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 5-(3,4-difluorophenyl)-1-(3,5-dimethylphenyl)triazole-4-carbaldehyde |
| SMILES | Cc1cc(C)cc(-n2nnc(C=O)c2-c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C17H13F2N3O/c1-10-5-11(2)7-13(6-10)22-17(16(9-23)20-21-22)12-3-4-14(18)15(19)8-12/h3-9H,1-2H3 |
| InChIKey | NVJFYBMOBCIRJD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|