C16H14N4O — CID 82198767
1-(3,5-dimethylphenyl)-5-pyridin-4-yltriazole-4-carbaldehyde (PubChem CID 82198767) has the molecular formula C16H14N4O and a molecular weight of 278.31 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-5-pyridin-4-yltriazole-4-carbaldehyde.
| Compound Name | 1-(3,5-dimethylphenyl)-5-pyridin-4-yltriazole-4-carbaldehyde |
|---|---|
| PubChem CID | 82198767 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-5-pyridin-4-yltriazole-4-carbaldehyde |
| SMILES | Cc1cc(C)cc(-n2nnc(C=O)c2-c2ccncc2)c1 |
| InChI | InChI=1S/C16H14N4O/c1-11-7-12(2)9-14(8-11)20-16(15(10-21)18-19-20)13-3-5-17-6-4-13/h3-10H,1-2H3 |
| InChIKey | CTXUMBHLQPVRDO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|