C19H19N3O — CID 82195119
5-(3,4-dimethylphenyl)-1-(2-ethylphenyl)triazole-4-carbaldehyde (PubChem CID 82195119) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-1-(2-ethylphenyl)triazole-4-carbaldehyde.
| Compound Name | 5-(3,4-dimethylphenyl)-1-(2-ethylphenyl)triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 82195119 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-1-(2-ethylphenyl)triazole-4-carbaldehyde |
| SMILES | CCc1ccccc1-n1nnc(C=O)c1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H19N3O/c1-4-15-7-5-6-8-18(15)22-19(17(12-23)20-21-22)16-10-9-13(2)14(3)11-16/h5-12H,4H2,1-3H3 |
| InChIKey | ICWIKCOXRXCFHV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|