C28H30N2 — CID 17025689
3,5-bis(3,4-dimethylphenyl)-1-(2-ethylphenyl)-4-methylpyrazole (PubChem CID 17025689) has the molecular formula C28H30N2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 3,5-bis(3,4-dimethylphenyl)-1-(2-ethylphenyl)-4-methylpyrazole.
| Compound Name | 3,5-bis(3,4-dimethylphenyl)-1-(2-ethylphenyl)-4-methylpyrazole |
|---|---|
| PubChem CID | 17025689 |
| Molecular Formula | C28H30N2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 3,5-bis(3,4-dimethylphenyl)-1-(2-ethylphenyl)-4-methylpyrazole |
| SMILES | CCc1ccccc1-n1nc(-c2ccc(C)c(C)c2)c(C)c1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C28H30N2/c1-7-23-10-8-9-11-26(23)30-28(25-15-13-19(3)21(5)17-25)22(6)27(29-30)24-14-12-18(2)20(4)16-24/h8-17H,7H2,1-6H3 |
| InChIKey | RDBSURLAVHJHTO-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |