About 4-chloro-1-(2-chlorophenyl)-3,5-bis(3,4-dimethylphenyl)pyrazole
4-chloro-1-(2-chlorophenyl)-3,5-bis(3,4-dimethylphenyl)pyrazole (PubChem CID 19586926) has the molecular formula C25H22Cl2N2
and a molecular weight of 421.37 g/mol. Its IUPAC name is 4-chloro-1-(2-chlorophenyl)-3,5-bis(3,4-dimethylphenyl)pyrazole.
Molecular Properties
| Compound Name | 4-chloro-1-(2-chlorophenyl)-3,5-bis(3,4-dimethylphenyl)pyrazole |
| PubChem CID | 19586926 |
| Molecular Formula | C25H22Cl2N2 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 4-chloro-1-(2-chlorophenyl)-3,5-bis(3,4-dimethylphenyl)pyrazole |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3Cl)c(-c3ccc(C)c(C)c3)c2Cl)cc1C |
| InChI | InChI=1S/C25H22Cl2N2/c1-15-9-11-19(13-17(15)3)24-23(27)25(20-12-10-16(2)18(4)14-20)29(28-24)22-8-6-5-7-21(22)26/h5-14H,1-4H3 |
| InChIKey | YWRYSENNNVTHFI-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-1-(2-chlorophenyl)-3,5-bis(3,4-dimethylphenyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-(2-chlorophenyl)-3,5-bis(3,4-dimethylphenyl)pyrazole?
The IUPAC name of 4-chloro-1-(2-chlorophenyl)-3,5-bis(3,4-dimethylphenyl)pyrazole (CID 19586926) is 4-chloro-1-(2-chlorophenyl)-3,5-bis(3,4-dimethylphenyl)pyrazole.
What is the SMILES notation for 4-chloro-1-(2-chlorophenyl)-3,5-bis(3,4-dimethylphenyl)pyrazole?
The canonical SMILES for 4-chloro-1-(2-chlorophenyl)-3,5-bis(3,4-dimethylphenyl)pyrazole is Cc1ccc(-c2nn(-c3ccccc3Cl)c(-c3ccc(C)c(C)c3)c2Cl)cc1C.
What is the InChIKey of 4-chloro-1-(2-chlorophenyl)-3,5-bis(3,4-dimethylphenyl)pyrazole?
The InChIKey is YWRYSENNNVTHFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22Cl2N2/c1-15-9-11-19(13-17(15)3)24-23(27)25(20-12-10-16(2)18(4)14-20)29(28-24)22-8-6-5-7-21(22)26/h5-14H,1-4H3.
What are the key properties of 4-chloro-1-(2-chlorophenyl)-3,5-bis(3,4-dimethylphenyl)pyrazole?
4-chloro-1-(2-chlorophenyl)-3,5-bis(3,4-dimethylphenyl)pyrazole has a molecular weight of 421.37 g/mol, XLogP of 7.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-(2-chlorophenyl)-3,5-bis(3,4-dimethylphenyl)pyrazole is sourced from PubChem (CID 19586926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).