C22H12Cl6N2 — CID 17025529
1-(2,4-dichlorophenyl)-3,5-bis(3,4-dichlorophenyl)-4-methylpyrazole (PubChem CID 17025529) has the molecular formula C22H12Cl6N2 and a molecular weight of 517.07 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3,5-bis(3,4-dichlorophenyl)-4-methylpyrazole.
| Compound Name | 1-(2,4-dichlorophenyl)-3,5-bis(3,4-dichlorophenyl)-4-methylpyrazole |
|---|---|
| PubChem CID | 17025529 |
| Molecular Formula | C22H12Cl6N2 |
| Molecular Weight | 517.07 g/mol |
| Exact Mass | 513.91 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3,5-bis(3,4-dichlorophenyl)-4-methylpyrazole |
| SMILES | Cc1c(-c2ccc(Cl)c(Cl)c2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H12Cl6N2/c1-11-21(12-2-5-15(24)17(26)8-12)29-30(20-7-4-14(23)10-19(20)28)22(11)13-3-6-16(25)18(27)9-13/h2-10H,1H3 |
| InChIKey | VPMPCWMCLHXXJA-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.07 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |