C17H13Cl2IN2O — CID 143943814
[1-(2,4-dichlorophenyl)-5-(4-iodophenyl)-4-methylpyrazol-3-yl]methanol (PubChem CID 143943814) has the molecular formula C17H13Cl2IN2O and a molecular weight of 459.11 g/mol. Its IUPAC name is [1-(2,4-dichlorophenyl)-5-(4-iodophenyl)-4-methylpyrazol-3-yl]methanol.
| Compound Name | [1-(2,4-dichlorophenyl)-5-(4-iodophenyl)-4-methylpyrazol-3-yl]methanol |
|---|---|
| PubChem CID | 143943814 |
| Molecular Formula | C17H13Cl2IN2O |
| Molecular Weight | 459.11 g/mol |
| Exact Mass | 457.94 |
| IUPAC Name | [1-(2,4-dichlorophenyl)-5-(4-iodophenyl)-4-methylpyrazol-3-yl]methanol |
| SMILES | Cc1c(CO)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(I)cc1 |
| InChI | InChI=1S/C17H13Cl2IN2O/c1-10-15(9-23)21-22(16-7-4-12(18)8-14(16)19)17(10)11-2-5-13(20)6-3-11/h2-8,23H,9H2,1H3 |
| InChIKey | OXTUJGGHJGISFA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.11 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|