C22H22Cl3IN4O — CID 46837031
1-(2,4-dichlorophenyl)-5-(4-iodophenyl)-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide;hydrochloride (PubChem CID 46837031) has the molecular formula C22H22Cl3IN4O and a molecular weight of 591.71 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-5-(4-iodophenyl)-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide;hydrochloride.
| Compound Name | 1-(2,4-dichlorophenyl)-5-(4-iodophenyl)-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 46837031 |
| Molecular Formula | C22H22Cl3IN4O |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 589.99 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-5-(4-iodophenyl)-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide;hydrochloride |
| SMILES | Cc1c(C(=O)NN2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(I)cc1.Cl |
| InChI | InChI=1S/C22H21Cl2IN4O.ClH/c1-14-20(22(30)27-28-11-3-2-4-12-28)26-29(19-10-7-16(23)13-18(19)24)21(14)15-5-8-17(25)9-6-15;/h5-10,13H,2-4,11-12H2,1H3,(H,27,30);1H |
| InChIKey | OLDJVIVMZSUUDK-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|