C25H25Cl2N5O — CID 59232507
5-[4-(3-aminoprop-1-ynyl)phenyl]-1-(2,4-dichlorophenyl)-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide (PubChem CID 59232507) has the molecular formula C25H25Cl2N5O and a molecular weight of 482.42 g/mol. Its IUPAC name is 5-[4-(3-aminoprop-1-ynyl)phenyl]-1-(2,4-dichlorophenyl)-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide.
| Compound Name | 5-[4-(3-aminoprop-1-ynyl)phenyl]-1-(2,4-dichlorophenyl)-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 59232507 |
| Molecular Formula | C25H25Cl2N5O |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 5-[4-(3-aminoprop-1-ynyl)phenyl]-1-(2,4-dichlorophenyl)-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NN2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(C#CCN)cc1 |
| InChI | InChI=1S/C25H25Cl2N5O/c1-17-23(25(33)30-31-14-3-2-4-15-31)29-32(22-12-11-20(26)16-21(22)27)24(17)19-9-7-18(8-10-19)6-5-13-28/h7-12,16H,2-4,13-15,28H2,1H3,(H,30,33) |
| InChIKey | XBMBMQPEZQNMSU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|