C31H34Cl2N4O3 — CID 161127210
tert-butyl 5-[4-[1-(2,4-dichlorophenyl)-4-methyl-3-(piperidin-1-ylcarbamoyl)pyrazol-5-yl]phenyl]pent-4-ynoate (PubChem CID 161127210) has the molecular formula C31H34Cl2N4O3 and a molecular weight of 581.54 g/mol. Its IUPAC name is tert-butyl 5-[4-[1-(2,4-dichlorophenyl)-4-methyl-3-(piperidin-1-ylcarbamoyl)pyrazol-5-yl]phenyl]pent-4-ynoate.
| Compound Name | tert-butyl 5-[4-[1-(2,4-dichlorophenyl)-4-methyl-3-(piperidin-1-ylcarbamoyl)pyrazol-5-yl]phenyl]pent-4-ynoate |
|---|---|
| PubChem CID | 161127210 |
| Molecular Formula | C31H34Cl2N4O3 |
| Molecular Weight | 581.54 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | tert-butyl 5-[4-[1-(2,4-dichlorophenyl)-4-methyl-3-(piperidin-1-ylcarbamoyl)pyrazol-5-yl]phenyl]pent-4-ynoate |
| SMILES | Cc1c(C(=O)NN2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(C#CCCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C31H34Cl2N4O3/c1-21-28(30(39)35-36-18-8-5-9-19-36)34-37(26-17-16-24(32)20-25(26)33)29(21)23-14-12-22(13-15-23)10-6-7-11-27(38)40-31(2,3)4/h12-17,20H,5,7-9,11,18-19H2,1-4H3,(H,35,39) |
| InChIKey | VQEFGWIIUOUBQD-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.54 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|