C24H26Cl2N4OS — CID 88873863
1-(2,4-dichlorophenyl)-4-methyl-N-piperidin-1-yl-5-[4-(2-sulfanylethyl)phenyl]pyrazole-3-carboxamide (PubChem CID 88873863) has the molecular formula C24H26Cl2N4OS and a molecular weight of 489.47 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-4-methyl-N-piperidin-1-yl-5-[4-(2-sulfanylethyl)phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-4-methyl-N-piperidin-1-yl-5-[4-(2-sulfanylethyl)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 88873863 |
| Molecular Formula | C24H26Cl2N4OS |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-4-methyl-N-piperidin-1-yl-5-[4-(2-sulfanylethyl)phenyl]pyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NN2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(CCS)cc1 |
| InChI | InChI=1S/C24H26Cl2N4OS/c1-16-22(24(31)28-29-12-3-2-4-13-29)27-30(21-10-9-19(25)15-20(21)26)23(16)18-7-5-17(6-8-18)11-14-32/h5-10,15,32H,2-4,11-14H2,1H3,(H,28,31) |
| InChIKey | FSTNYRPWAVQLSR-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|