C26H30Cl2N4O3 — CID 59232563
1-(2,4-dichlorophenyl)-5-[4-(4-hydroxybutyl)phenyl]-4-(hydroxymethyl)-N-piperidin-1-ylpyrazole-3-carboxamide (PubChem CID 59232563) has the molecular formula C26H30Cl2N4O3 and a molecular weight of 517.46 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-5-[4-(4-hydroxybutyl)phenyl]-4-(hydroxymethyl)-N-piperidin-1-ylpyrazole-3-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-5-[4-(4-hydroxybutyl)phenyl]-4-(hydroxymethyl)-N-piperidin-1-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 59232563 |
| Molecular Formula | C26H30Cl2N4O3 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-5-[4-(4-hydroxybutyl)phenyl]-4-(hydroxymethyl)-N-piperidin-1-ylpyrazole-3-carboxamide |
| SMILES | O=C(NN1CCCCC1)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(CCCCO)cc2)c1CO |
| InChI | InChI=1S/C26H30Cl2N4O3/c27-20-11-12-23(22(28)16-20)32-25(19-9-7-18(8-10-19)6-2-5-15-33)21(17-34)24(29-32)26(35)30-31-13-3-1-4-14-31/h7-12,16,33-34H,1-6,13-15,17H2,(H,30,35) |
| InChIKey | UCINPNFLUDPOLA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|