C25H24Cl2N4O2 — CID 59232565
1-(2,4-dichlorophenyl)-5-[4-(3-hydroxyprop-1-ynyl)phenyl]-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide (PubChem CID 59232565) has the molecular formula C25H24Cl2N4O2 and a molecular weight of 483.40 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-5-[4-(3-hydroxyprop-1-ynyl)phenyl]-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-5-[4-(3-hydroxyprop-1-ynyl)phenyl]-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 59232565 |
| Molecular Formula | C25H24Cl2N4O2 |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-5-[4-(3-hydroxyprop-1-ynyl)phenyl]-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NN2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(C#CCO)cc1 |
| InChI | InChI=1S/C25H24Cl2N4O2/c1-17-23(25(33)29-30-13-3-2-4-14-30)28-31(22-12-11-20(26)16-21(22)27)24(17)19-9-7-18(8-10-19)6-5-15-32/h7-12,16,32H,2-4,13-15H2,1H3,(H,29,33) |
| InChIKey | AAYCAVFUPFBRBT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|