C27H25Cl2N5O — CID 59232515
1-(2,4-dichlorophenyl)-5-[4-(4-isocyanobut-1-ynyl)phenyl]-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide (PubChem CID 59232515) has the molecular formula C27H25Cl2N5O and a molecular weight of 506.44 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-5-[4-(4-isocyanobut-1-ynyl)phenyl]-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-5-[4-(4-isocyanobut-1-ynyl)phenyl]-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 59232515 |
| Molecular Formula | C27H25Cl2N5O |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-5-[4-(4-isocyanobut-1-ynyl)phenyl]-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide |
| SMILES | [C-]#[N+]CCC#Cc1ccc(-c2c(C)c(C(=O)NN3CCCCC3)nn2-c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C27H25Cl2N5O/c1-19-25(27(35)32-33-16-6-3-7-17-33)31-34(24-14-13-22(28)18-23(24)29)26(19)21-11-9-20(10-12-21)8-4-5-15-30-2/h9-14,18H,3,5-7,15-17H2,1H3,(H,32,35) |
| InChIKey | QXQVVEWPMJVTED-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|