C34H38Cl2F3N5O5 — CID 155540943
4-[4-[1-(2,4-dichlorophenyl)-4-methyl-3-(piperidin-1-ylcarbamoyl)pyrazol-5-yl]phenyl]but-3-ynyl 6-aminohexanoate;2,2,2-trifluoroacetic acid (PubChem CID 155540943) has the molecular formula C34H38Cl2F3N5O5 and a molecular weight of 724.61 g/mol. Its IUPAC name is 4-[4-[1-(2,4-dichlorophenyl)-4-methyl-3-(piperidin-1-ylcarbamoyl)pyrazol-5-yl]phenyl]but-3-ynyl 6-aminohexanoate;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[4-[1-(2,4-dichlorophenyl)-4-methyl-3-(piperidin-1-ylcarbamoyl)pyrazol-5-yl]phenyl]but-3-ynyl 6-aminohexanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155540943 |
| Molecular Formula | C34H38Cl2F3N5O5 |
| Molecular Weight | 724.61 g/mol |
| Exact Mass | 723.22 |
| IUPAC Name | 4-[4-[1-(2,4-dichlorophenyl)-4-methyl-3-(piperidin-1-ylcarbamoyl)pyrazol-5-yl]phenyl]but-3-ynyl 6-aminohexanoate;2,2,2-trifluoroacetic acid |
| SMILES | Cc1c(C(=O)NN2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(C#CCCOC(=O)CCCCCN)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C32H37Cl2N5O3.C2HF3O2/c1-23-30(32(41)37-38-19-7-3-8-20-38)36-39(28-17-16-26(33)22-27(28)34)31(23)25-14-12-24(13-15-25)10-5-9-21-42-29(40)11-4-2-6-18-35;3-2(4,5)1(6)7/h12-17,22H,2-4,6-9,11,18-21,35H2,1H3,(H,37,41);(H,6,7) |
| InChIKey | WGYPRGQPYNMSDN-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 139.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.61 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|