C26H26Cl2N4O — CID 122198481
5-(4-but-1-ynylphenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide (PubChem CID 122198481) has the molecular formula C26H26Cl2N4O and a molecular weight of 481.43 g/mol. Its IUPAC name is 5-(4-but-1-ynylphenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide.
| Compound Name | 5-(4-but-1-ynylphenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 122198481 |
| Molecular Formula | C26H26Cl2N4O |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 5-(4-but-1-ynylphenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide |
| SMILES | CCC#Cc1ccc(-c2c(C)c(C(=O)NN3CCCCC3)nn2-c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C26H26Cl2N4O/c1-3-4-8-19-9-11-20(12-10-19)25-18(2)24(26(33)30-31-15-6-5-7-16-31)29-32(25)23-14-13-21(27)17-22(23)28/h9-14,17H,3,5-7,15-16H2,1-2H3,(H,30,33) |
| InChIKey | AYHQTNYVNUCETG-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|