C23H23Cl2N5O3 — CID 162713195
1-(2,4-dichlorophenyl)-5-[4-(hydroxycarbamoyl)phenyl]-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide (PubChem CID 162713195) has the molecular formula C23H23Cl2N5O3 and a molecular weight of 488.38 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-5-[4-(hydroxycarbamoyl)phenyl]-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-5-[4-(hydroxycarbamoyl)phenyl]-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 162713195 |
| Molecular Formula | C23H23Cl2N5O3 |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-5-[4-(hydroxycarbamoyl)phenyl]-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NN2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C23H23Cl2N5O3/c1-14-20(23(32)27-29-11-3-2-4-12-29)26-30(19-10-9-17(24)13-18(19)25)21(14)15-5-7-16(8-6-15)22(31)28-33/h5-10,13,33H,2-4,11-12H2,1H3,(H,27,32)(H,28,31) |
| InChIKey | IXRHHQUNQKHVRO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|