C28H27Cl2N5O — CID 88570590
1-(2,4-dichlorophenyl)-4-ethyl-5-[4-(4-isocyanobut-1-ynyl)phenyl]-N-piperidin-1-ylpyrazole-3-carboxamide (PubChem CID 88570590) has the molecular formula C28H27Cl2N5O and a molecular weight of 520.46 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-4-ethyl-5-[4-(4-isocyanobut-1-ynyl)phenyl]-N-piperidin-1-ylpyrazole-3-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-4-ethyl-5-[4-(4-isocyanobut-1-ynyl)phenyl]-N-piperidin-1-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 88570590 |
| Molecular Formula | C28H27Cl2N5O |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-4-ethyl-5-[4-(4-isocyanobut-1-ynyl)phenyl]-N-piperidin-1-ylpyrazole-3-carboxamide |
| SMILES | [C-]#[N+]CCC#Cc1ccc(-c2c(CC)c(C(=O)NN3CCCCC3)nn2-c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C28H27Cl2N5O/c1-3-23-26(28(36)33-34-17-7-4-8-18-34)32-35(25-15-14-22(29)19-24(25)30)27(23)21-12-10-20(11-13-21)9-5-6-16-31-2/h10-15,19H,3-4,6-8,16-18H2,1H3,(H,33,36) |
| InChIKey | LJJKRNOGXOJCHN-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|