C25H23Cl2N5O6 — CID 121249328
4-[4-[2-(2,4-dichlorophenyl)-4-methoxy-5-(morpholin-4-ylcarbamoyl)pyrazol-3-yl]phenyl]but-3-ynyl nitrate (PubChem CID 121249328) has the molecular formula C25H23Cl2N5O6 and a molecular weight of 560.39 g/mol. Its IUPAC name is 4-[4-[2-(2,4-dichlorophenyl)-4-methoxy-5-(morpholin-4-ylcarbamoyl)pyrazol-3-yl]phenyl]but-3-ynyl nitrate.
| Compound Name | 4-[4-[2-(2,4-dichlorophenyl)-4-methoxy-5-(morpholin-4-ylcarbamoyl)pyrazol-3-yl]phenyl]but-3-ynyl nitrate |
|---|---|
| PubChem CID | 121249328 |
| Molecular Formula | C25H23Cl2N5O6 |
| Molecular Weight | 560.39 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | 4-[4-[2-(2,4-dichlorophenyl)-4-methoxy-5-(morpholin-4-ylcarbamoyl)pyrazol-3-yl]phenyl]but-3-ynyl nitrate |
| SMILES | COc1c(C(=O)NN2CCOCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(C#CCCO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H23Cl2N5O6/c1-36-24-22(25(33)29-30-11-14-37-15-12-30)28-31(21-10-9-19(26)16-20(21)27)23(24)18-7-5-17(6-8-18)4-2-3-13-38-32(34)35/h5-10,16H,3,11-15H2,1H3,(H,29,33) |
| InChIKey | DEBVYPQVLGODFE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 120.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|