C22H15Cl2N3O2 — CID 162705701
5-[4-(4-cyanobut-1-ynyl)phenyl]-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxylic acid (PubChem CID 162705701) has the molecular formula C22H15Cl2N3O2 and a molecular weight of 424.29 g/mol. Its IUPAC name is 5-[4-(4-cyanobut-1-ynyl)phenyl]-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxylic acid.
| Compound Name | 5-[4-(4-cyanobut-1-ynyl)phenyl]-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 162705701 |
| Molecular Formula | C22H15Cl2N3O2 |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 5-[4-(4-cyanobut-1-ynyl)phenyl]-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxylic acid |
| SMILES | Cc1c(C(=O)O)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(C#CCCC#N)cc1 |
| InChI | InChI=1S/C22H15Cl2N3O2/c1-14-20(22(28)29)26-27(19-11-10-17(23)13-18(19)24)21(14)16-8-6-15(7-9-16)5-3-2-4-12-25/h6-11,13H,2,4H2,1H3,(H,28,29) |
| InChIKey | ARFRSAXSHYCOGR-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|