C18H15Cl3N4O — CID 69235606
N-(aminomethyl)-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide (PubChem CID 69235606) has the molecular formula C18H15Cl3N4O and a molecular weight of 409.70 g/mol. Its IUPAC name is N-(aminomethyl)-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | N-(aminomethyl)-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 69235606 |
| Molecular Formula | C18H15Cl3N4O |
| Molecular Weight | 409.70 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | N-(aminomethyl)-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCN)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15Cl3N4O/c1-10-16(18(26)23-9-22)24-25(15-7-6-13(20)8-14(15)21)17(10)11-2-4-12(19)5-3-11/h2-8H,9,22H2,1H3,(H,23,26) |
| InChIKey | QOFAFNBSUBKENU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.70 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|