C24H27Cl3N4O — CID 129010774
5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-[3-(diethylamino)propyl]-4-methylpyrazole-3-carboxamide (PubChem CID 129010774) has the molecular formula C24H27Cl3N4O and a molecular weight of 493.87 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-[3-(diethylamino)propyl]-4-methylpyrazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-[3-(diethylamino)propyl]-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 129010774 |
| Molecular Formula | C24H27Cl3N4O |
| Molecular Weight | 493.87 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-[3-(diethylamino)propyl]-4-methylpyrazole-3-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C24H27Cl3N4O/c1-4-30(5-2)14-6-13-28-24(32)22-16(3)23(17-7-9-18(25)10-8-17)31(29-22)21-12-11-19(26)15-20(21)27/h7-12,15H,4-6,13-14H2,1-3H3,(H,28,32) |
| InChIKey | HRKFKTITVUEMDH-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.87 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|