C26H32Cl3N3O4Si — CID 86567493
5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-(3-triethoxysilylpropyl)pyrazole-3-carboxamide (PubChem CID 86567493) has the molecular formula C26H32Cl3N3O4Si and a molecular weight of 585.00 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-(3-triethoxysilylpropyl)pyrazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-(3-triethoxysilylpropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 86567493 |
| Molecular Formula | C26H32Cl3N3O4Si |
| Molecular Weight | 585.00 g/mol |
| Exact Mass | 583.12 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-(3-triethoxysilylpropyl)pyrazole-3-carboxamide |
| SMILES | CCO[Si](CCCNC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1C)(OCC)OCC |
| InChI | InChI=1S/C26H32Cl3N3O4Si/c1-5-34-37(35-6-2,36-7-3)16-8-15-30-26(33)24-18(4)25(19-9-11-20(27)12-10-19)32(31-24)23-14-13-21(28)17-22(23)29/h9-14,17H,5-8,15-16H2,1-4H3,(H,30,33) |
| InChIKey | UGABHVTWMDDXKL-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.00 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|