C18H16Cl2N4O — CID 59703686
1-(2,4-dichlorophenyl)-4-methyl-5-(4-methylphenyl)pyrazole-3-carbohydrazide (PubChem CID 59703686) has the molecular formula C18H16Cl2N4O and a molecular weight of 375.26 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-4-methyl-5-(4-methylphenyl)pyrazole-3-carbohydrazide.
| Compound Name | 1-(2,4-dichlorophenyl)-4-methyl-5-(4-methylphenyl)pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 59703686 |
| Molecular Formula | C18H16Cl2N4O |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-4-methyl-5-(4-methylphenyl)pyrazole-3-carbohydrazide |
| SMILES | Cc1ccc(-c2c(C)c(C(=O)NN)nn2-c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H16Cl2N4O/c1-10-3-5-12(6-4-10)17-11(2)16(18(25)22-21)23-24(17)15-8-7-13(19)9-14(15)20/h3-9H,21H2,1-2H3,(H,22,25) |
| InChIKey | OWNUNOVUYIBXKW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|