C21H20Cl3N3O — CID 11102177
N-butyl-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide (PubChem CID 11102177) has the molecular formula C21H20Cl3N3O and a molecular weight of 436.77 g/mol. Its IUPAC name is N-butyl-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | N-butyl-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 11102177 |
| Molecular Formula | C21H20Cl3N3O |
| Molecular Weight | 436.77 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | N-butyl-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide |
| SMILES | CCCCNC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C21H20Cl3N3O/c1-3-4-11-25-21(28)19-13(2)20(14-5-7-15(22)8-6-14)27(26-19)18-10-9-16(23)12-17(18)24/h5-10,12H,3-4,11H2,1-2H3,(H,25,28) |
| InChIKey | UMLUCOPZERDAMH-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.77 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|