C32H40Cl3N3O — CID 166949062
5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-(9-ethyl-9-methyldodec-11-enyl)-4-methylpyrazole-3-carboxamide (PubChem CID 166949062) has the molecular formula C32H40Cl3N3O and a molecular weight of 589.05 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-(9-ethyl-9-methyldodec-11-enyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-(9-ethyl-9-methyldodec-11-enyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 166949062 |
| Molecular Formula | C32H40Cl3N3O |
| Molecular Weight | 589.05 g/mol |
| Exact Mass | 587.22 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-(9-ethyl-9-methyldodec-11-enyl)-4-methylpyrazole-3-carboxamide |
| SMILES | C=CCC(C)(CC)CCCCCCCCNC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C32H40Cl3N3O/c1-5-19-32(4,6-2)20-11-9-7-8-10-12-21-36-31(39)29-23(3)30(24-13-15-25(33)16-14-24)38(37-29)28-18-17-26(34)22-27(28)35/h5,13-18,22H,1,6-12,19-21H2,2-4H3,(H,36,39) |
| InChIKey | UPXJQMJVURCKPR-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.05 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|