C32H41Cl3N4O — CID 166948840
5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-[7-(3-ethylhex-5-en-3-ylamino)heptyl]-4-methylpyrazole-3-carboxamide (PubChem CID 166948840) has the molecular formula C32H41Cl3N4O and a molecular weight of 604.07 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-[7-(3-ethylhex-5-en-3-ylamino)heptyl]-4-methylpyrazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-[7-(3-ethylhex-5-en-3-ylamino)heptyl]-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 166948840 |
| Molecular Formula | C32H41Cl3N4O |
| Molecular Weight | 604.07 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-[7-(3-ethylhex-5-en-3-ylamino)heptyl]-4-methylpyrazole-3-carboxamide |
| SMILES | C=CCC(CC)(CC)NCCCCCCCNC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C32H41Cl3N4O/c1-5-19-32(6-2,7-3)37-21-12-10-8-9-11-20-36-31(40)29-23(4)30(24-13-15-25(33)16-14-24)39(38-29)28-18-17-26(34)22-27(28)35/h5,13-18,22,37H,1,6-12,19-21H2,2-4H3,(H,36,40) |
| InChIKey | AEHGRKDFMFFAGE-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.07 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|