C41H34Cl6N6O4 — CID 141268030
methyl (2R)-2,6-bis[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carbonyl]amino]hexanoate (PubChem CID 141268030) has the molecular formula C41H34Cl6N6O4 and a molecular weight of 887.48 g/mol. Its IUPAC name is methyl (2R)-2,6-bis[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carbonyl]amino]hexanoate.
| Compound Name | methyl (2R)-2,6-bis[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 141268030 |
| Molecular Formula | C41H34Cl6N6O4 |
| Molecular Weight | 887.48 g/mol |
| Exact Mass | 884.08 |
| IUPAC Name | methyl (2R)-2,6-bis[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carbonyl]amino]hexanoate |
| SMILES | COC(=O)[C@@H](CCCCNC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1C)NC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C41H34Cl6N6O4/c1-22-35(50-52(33-17-15-28(44)20-30(33)46)37(22)24-7-11-26(42)12-8-24)39(54)48-19-5-4-6-32(41(56)57-3)49-40(55)36-23(2)38(25-9-13-27(43)14-10-25)53(51-36)34-18-16-29(45)21-31(34)47/h7-18,20-21,32H,4-6,19H2,1-3H3,(H,48,54)(H,49,55)/t32-/m1/s1 |
| InChIKey | MDILWGRJHNWQNS-JGCGQSQUSA-N |
| XLogP | 10.80 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.48 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|