C20H18Cl3N3O2 — CID 10884669
5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-(3-hydroxypropyl)-4-methylpyrazole-3-carboxamide (PubChem CID 10884669) has the molecular formula C20H18Cl3N3O2 and a molecular weight of 438.74 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-(3-hydroxypropyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-(3-hydroxypropyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 10884669 |
| Molecular Formula | C20H18Cl3N3O2 |
| Molecular Weight | 438.74 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-(3-hydroxypropyl)-4-methylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCCO)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18Cl3N3O2/c1-12-18(20(28)24-9-2-10-27)25-26(17-8-7-15(22)11-16(17)23)19(12)13-3-5-14(21)6-4-13/h3-8,11,27H,2,9-10H2,1H3,(H,24,28) |
| InChIKey | NLXMPBZCLYDHPG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.74 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|