C23H22Cl3N3O3 — CID 24748275
ethyl 4-[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carbonyl]amino]butanoate (PubChem CID 24748275) has the molecular formula C23H22Cl3N3O3 and a molecular weight of 494.81 g/mol. Its IUPAC name is ethyl 4-[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carbonyl]amino]butanoate.
| Compound Name | ethyl 4-[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 24748275 |
| Molecular Formula | C23H22Cl3N3O3 |
| Molecular Weight | 494.81 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | ethyl 4-[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carbonyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C23H22Cl3N3O3/c1-3-32-20(30)5-4-12-27-23(31)21-14(2)22(15-6-8-16(24)9-7-15)29(28-21)19-11-10-17(25)13-18(19)26/h6-11,13H,3-5,12H2,1-2H3,(H,27,31) |
| InChIKey | SGWSDHMXWSUQAP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.81 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|