C54H54Cl6N8O4 — CID 118710164
1-N,3-N-bis[4-[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carbonyl]amino]butyl]adamantane-1,3-dicarboxamide (PubChem CID 118710164) has the molecular formula C54H54Cl6N8O4 and a molecular weight of 1091.80 g/mol. Its IUPAC name is 1-N,3-N-bis[4-[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carbonyl]amino]butyl]adamantane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[4-[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carbonyl]amino]butyl]adamantane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 118710164 |
| Molecular Formula | C54H54Cl6N8O4 |
| Molecular Weight | 1091.80 g/mol |
| Exact Mass | 1088.24 |
| IUPAC Name | 1-N,3-N-bis[4-[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carbonyl]amino]butyl]adamantane-1,3-dicarboxamide |
| SMILES | Cc1c(C(=O)NCCCCNC(=O)C23CC4CC(C2)CC(C(=O)NCCCCNC(=O)c2nn(-c5ccc(Cl)cc5Cl)c(-c5ccc(Cl)cc5)c2C)(C4)C3)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C54H54Cl6N8O4/c1-31-45(65-67(43-17-15-39(57)24-41(43)59)47(31)35-7-11-37(55)12-8-35)49(69)61-19-3-5-21-63-51(71)53-26-33-23-34(27-53)29-54(28-33,30-53)52(72)64-22-6-4-20-62-50(70)46-32(2)48(36-9-13-38(56)14-10-36)68(66-46)44-18-16-40(58)25-42(44)60/h7-18,24-25,33-34H,3-6,19-23,26-30H2,1-2H3,(H,61,69)(H,62,70)(H,63,71)(H,64,72) |
| InChIKey | WKZBYKWJIPDLHQ-UHFFFAOYSA-N |
| XLogP | 12.47 |
| TPSA | 152.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1091.80 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|