C30H33Cl3N4O — CID 162699766
N-[2-(2-adamantylmethylamino)ethyl]-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide (PubChem CID 162699766) has the molecular formula C30H33Cl3N4O and a molecular weight of 571.98 g/mol. Its IUPAC name is N-[2-(2-adamantylmethylamino)ethyl]-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | N-[2-(2-adamantylmethylamino)ethyl]-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 162699766 |
| Molecular Formula | C30H33Cl3N4O |
| Molecular Weight | 571.98 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | N-[2-(2-adamantylmethylamino)ethyl]-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCNCC2C3CC4CC(C3)CC2C4)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H33Cl3N4O/c1-17-28(30(38)35-9-8-34-16-25-21-11-18-10-19(13-21)14-22(25)12-18)36-37(27-7-6-24(32)15-26(27)33)29(17)20-2-4-23(31)5-3-20/h2-7,15,18-19,21-22,25,34H,8-14,16H2,1H3,(H,35,38) |
| InChIKey | ZWLUBRWTHUERMH-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.98 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|