C30H32ClF2N3O — CID 163685336
N-[3-(2-adamantyl)propyl]-5-(4-chlorophenyl)-1-(2,4-difluorophenyl)-4-methylpyrazole-3-carboxamide (PubChem CID 163685336) has the molecular formula C30H32ClF2N3O and a molecular weight of 524.06 g/mol. Its IUPAC name is N-[3-(2-adamantyl)propyl]-5-(4-chlorophenyl)-1-(2,4-difluorophenyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | N-[3-(2-adamantyl)propyl]-5-(4-chlorophenyl)-1-(2,4-difluorophenyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 163685336 |
| Molecular Formula | C30H32ClF2N3O |
| Molecular Weight | 524.06 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | N-[3-(2-adamantyl)propyl]-5-(4-chlorophenyl)-1-(2,4-difluorophenyl)-4-methylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCCC2C3CC4CC(C3)CC2C4)nn(-c2ccc(F)cc2F)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H32ClF2N3O/c1-17-28(30(37)34-10-2-3-25-21-12-18-11-19(14-21)15-22(25)13-18)35-36(27-9-8-24(32)16-26(27)33)29(17)20-4-6-23(31)7-5-20/h4-9,16,18-19,21-22,25H,2-3,10-15H2,1H3,(H,34,37) |
| InChIKey | JOJQUIVIDPEEHR-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.06 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|