C27H35Cl2N3O — CID 163820829
N-[3-(2-adamantyl)propyl]-1-(2,4-dichlorophenyl)-4-methyl-5-propan-2-ylpyrazole-3-carboxamide (PubChem CID 163820829) has the molecular formula C27H35Cl2N3O and a molecular weight of 488.50 g/mol. Its IUPAC name is N-[3-(2-adamantyl)propyl]-1-(2,4-dichlorophenyl)-4-methyl-5-propan-2-ylpyrazole-3-carboxamide.
| Compound Name | N-[3-(2-adamantyl)propyl]-1-(2,4-dichlorophenyl)-4-methyl-5-propan-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 163820829 |
| Molecular Formula | C27H35Cl2N3O |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | N-[3-(2-adamantyl)propyl]-1-(2,4-dichlorophenyl)-4-methyl-5-propan-2-ylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCCC2C3CC4CC(C3)CC2C4)nn(-c2ccc(Cl)cc2Cl)c1C(C)C |
| InChI | InChI=1S/C27H35Cl2N3O/c1-15(2)26-16(3)25(31-32(26)24-7-6-21(28)14-23(24)29)27(33)30-8-4-5-22-19-10-17-9-18(12-19)13-20(22)11-17/h6-7,14-15,17-20,22H,4-5,8-13H2,1-3H3,(H,30,33) |
| InChIKey | NVGGYERSGSOCBM-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|