C30H34Cl3N3 — CID 163624803
3-(2-adamantyl)-N-[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]methyl]propan-1-amine (PubChem CID 163624803) has the molecular formula C30H34Cl3N3 and a molecular weight of 542.98 g/mol. Its IUPAC name is 3-(2-adamantyl)-N-[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]methyl]propan-1-amine.
| Compound Name | 3-(2-adamantyl)-N-[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 163624803 |
| Molecular Formula | C30H34Cl3N3 |
| Molecular Weight | 542.98 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | 3-(2-adamantyl)-N-[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]methyl]propan-1-amine |
| SMILES | Cc1c(CNCCCC2C3CC4CC(C3)CC2C4)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H34Cl3N3/c1-18-28(17-34-10-2-3-26-22-12-19-11-20(14-22)15-23(26)13-19)35-36(29-9-8-25(32)16-27(29)33)30(18)21-4-6-24(31)7-5-21/h4-9,16,19-20,22-23,26,34H,2-3,10-15,17H2,1H3 |
| InChIKey | HRDAUIKMJWIFBP-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.98 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|