C20H16Cl3N3O — CID 162699825
N-[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]methyl]prop-2-enamide (PubChem CID 162699825) has the molecular formula C20H16Cl3N3O and a molecular weight of 420.73 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]methyl]prop-2-enamide.
| Compound Name | N-[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 162699825 |
| Molecular Formula | C20H16Cl3N3O |
| Molecular Weight | 420.73 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | N-[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C20H16Cl3N3O/c1-3-19(27)24-11-17-12(2)20(13-4-6-14(21)7-5-13)26(25-17)18-9-8-15(22)10-16(18)23/h3-10H,1,11H2,2H3,(H,24,27) |
| InChIKey | WBOIJUKBEOOOHJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.73 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|