C22H20Cl3N3O2 — CID 142544561
2-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]-N-(2-methylpropyl)-2-oxoacetamide (PubChem CID 142544561) has the molecular formula C22H20Cl3N3O2 and a molecular weight of 464.78 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]-N-(2-methylpropyl)-2-oxoacetamide.
| Compound Name | 2-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]-N-(2-methylpropyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 142544561 |
| Molecular Formula | C22H20Cl3N3O2 |
| Molecular Weight | 464.78 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]-N-(2-methylpropyl)-2-oxoacetamide |
| SMILES | Cc1c(C(=O)C(=O)NCC(C)C)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20Cl3N3O2/c1-12(2)11-26-22(30)21(29)19-13(3)20(14-4-6-15(23)7-5-14)28(27-19)18-9-8-16(24)10-17(18)25/h4-10,12H,11H2,1-3H3,(H,26,30) |
| InChIKey | DOJWSGNKCRXGGH-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.78 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|