C31H33Cl3N2O2 — CID 163728726
4-(2-adamantylmethoxy)-1-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]butan-1-one (PubChem CID 163728726) has the molecular formula C31H33Cl3N2O2 and a molecular weight of 571.98 g/mol. Its IUPAC name is 4-(2-adamantylmethoxy)-1-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]butan-1-one.
| Compound Name | 4-(2-adamantylmethoxy)-1-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]butan-1-one |
|---|---|
| PubChem CID | 163728726 |
| Molecular Formula | C31H33Cl3N2O2 |
| Molecular Weight | 571.98 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | 4-(2-adamantylmethoxy)-1-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]butan-1-one |
| SMILES | Cc1c(C(=O)CCCOCC2C3CC4CC(C3)CC2C4)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H33Cl3N2O2/c1-18-30(29(37)3-2-10-38-17-26-22-12-19-11-20(14-22)15-23(26)13-19)35-36(28-9-8-25(33)16-27(28)34)31(18)21-4-6-24(32)7-5-21/h4-9,16,19-20,22-23,26H,2-3,10-15,17H2,1H3 |
| InChIKey | KXUGSTMZQVARAK-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.98 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|