C32H35Cl3N2O2 — CID 163554741
4-[2-(1-adamantyl)ethoxy]-1-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]butan-1-one (PubChem CID 163554741) has the molecular formula C32H35Cl3N2O2 and a molecular weight of 586.00 g/mol. Its IUPAC name is 4-[2-(1-adamantyl)ethoxy]-1-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]butan-1-one.
| Compound Name | 4-[2-(1-adamantyl)ethoxy]-1-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]butan-1-one |
|---|---|
| PubChem CID | 163554741 |
| Molecular Formula | C32H35Cl3N2O2 |
| Molecular Weight | 586.00 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | 4-[2-(1-adamantyl)ethoxy]-1-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]butan-1-one |
| SMILES | Cc1c(C(=O)CCCOCCC23CC4CC(CC(C4)C2)C3)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H35Cl3N2O2/c1-20-30(29(38)3-2-11-39-12-10-32-17-21-13-22(18-32)15-23(14-21)19-32)36-37(28-9-8-26(34)16-27(28)35)31(20)24-4-6-25(33)7-5-24/h4-9,16,21-23H,2-3,10-15,17-19H2,1H3 |
| InChIKey | FMBPMLUAJLJANR-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.00 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|