C26H27Cl3N3O3 — CID 164738464
CID 164738464 (PubChem CID 164738464) has the molecular formula C26H27Cl3N3O3 and a molecular weight of 535.88 g/mol.
| Compound Name | CID 164738464 |
|---|---|
| PubChem CID | 164738464 |
| Molecular Formula | C26H27Cl3N3O3 |
| Molecular Weight | 535.88 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | — |
| SMILES | Cc1c(C(=O)OC2CC(C)(C)N([O])C(C)(C)C2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H27Cl3N3O3/c1-15-22(24(33)35-19-13-25(2,3)32(34)26(4,5)14-19)30-31(21-11-10-18(28)12-20(21)29)23(15)16-6-8-17(27)9-7-16/h6-12,19H,13-14H2,1-5H3 |
| InChIKey | USENDJNXNYEYES-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 67.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.88 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |