C17H12Cl2IN3O — CID 118923029
1-(2,4-dichlorophenyl)-5-(4-iodophenyl)-4-methylpyrazole-3-carboxamide (PubChem CID 118923029) has the molecular formula C17H12Cl2IN3O and a molecular weight of 472.11 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-5-(4-iodophenyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-5-(4-iodophenyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 118923029 |
| Molecular Formula | C17H12Cl2IN3O |
| Molecular Weight | 472.11 g/mol |
| Exact Mass | 470.94 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-5-(4-iodophenyl)-4-methylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(N)=O)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(I)cc1 |
| InChI | InChI=1S/C17H12Cl2IN3O/c1-9-15(17(21)24)22-23(14-7-4-11(18)8-13(14)19)16(9)10-2-5-12(20)6-3-10/h2-8H,1H3,(H2,21,24) |
| InChIKey | FLNBHBOIMUCNAS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.11 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|