C32H38ClN3O — CID 163427608
N-[3-(2-adamantyl)propyl]-5-(4-chlorophenyl)-1-(3,5-dimethylphenyl)-4-methylpyrazole-3-carboxamide (PubChem CID 163427608) has the molecular formula C32H38ClN3O and a molecular weight of 516.13 g/mol. Its IUPAC name is N-[3-(2-adamantyl)propyl]-5-(4-chlorophenyl)-1-(3,5-dimethylphenyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | N-[3-(2-adamantyl)propyl]-5-(4-chlorophenyl)-1-(3,5-dimethylphenyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 163427608 |
| Molecular Formula | C32H38ClN3O |
| Molecular Weight | 516.13 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | N-[3-(2-adamantyl)propyl]-5-(4-chlorophenyl)-1-(3,5-dimethylphenyl)-4-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C)cc(-n2nc(C(=O)NCCCC3C4CC5CC(C4)CC3C5)c(C)c2-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C32H38ClN3O/c1-19-11-20(2)13-28(12-19)36-31(24-6-8-27(33)9-7-24)21(3)30(35-36)32(37)34-10-4-5-29-25-15-22-14-23(17-25)18-26(29)16-22/h6-9,11-13,22-23,25-26,29H,4-5,10,14-18H2,1-3H3,(H,34,37) |
| InChIKey | ANWJNYAFWXKDEN-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.13 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|