C30H32ClN5O — CID 166948854
N-[2-(2-adamantylamino)ethyl]-5-(4-chlorophenyl)-1-(4-cyanophenyl)-4-methylpyrazole-3-carboxamide (PubChem CID 166948854) has the molecular formula C30H32ClN5O and a molecular weight of 514.07 g/mol. Its IUPAC name is N-[2-(2-adamantylamino)ethyl]-5-(4-chlorophenyl)-1-(4-cyanophenyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | N-[2-(2-adamantylamino)ethyl]-5-(4-chlorophenyl)-1-(4-cyanophenyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 166948854 |
| Molecular Formula | C30H32ClN5O |
| Molecular Weight | 514.07 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | N-[2-(2-adamantylamino)ethyl]-5-(4-chlorophenyl)-1-(4-cyanophenyl)-4-methylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCNC2C3CC4CC(C3)CC2C4)nn(-c2ccc(C#N)cc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H32ClN5O/c1-18-27(30(37)34-11-10-33-28-23-13-20-12-21(15-23)16-24(28)14-20)35-36(26-8-2-19(17-32)3-9-26)29(18)22-4-6-25(31)7-5-22/h2-9,20-21,23-24,28,33H,10-16H2,1H3,(H,34,37) |
| InChIKey | FQYPGSSGUFZACG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.07 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|