1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxylic acid

C17H12Cl2N2O2 — CID 66641410

IUPAC1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxylic acid
SMILESCc1c(C(=O)O)nn(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1
InChIInChI=1S/C17H12Cl2N2O2/c1-10-15(17(22)23)20-21(14-8-6-13(19)7-9-14)16(10)11-2-4-12(18)5-3-11/h2-9H,1H3,(H,22,23)
InChIKeyYOCGFKLWNLDRBJ-UHFFFAOYSA-N
MW347.20 g/mol
LogP4.85
Rot. Bonds3

About 1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxylic acid

1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxylic acid (PubChem CID 66641410) has the molecular formula C17H12Cl2N2O2 and a molecular weight of 347.20 g/mol. Its IUPAC name is 1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxylic acid.

Molecular Properties

Compound Name1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxylic acid
PubChem CID66641410
Molecular FormulaC17H12Cl2N2O2
Molecular Weight347.20 g/mol
Exact Mass346.03
IUPAC Name1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxylic acid
SMILESCc1c(C(=O)O)nn(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1
InChIInChI=1S/C17H12Cl2N2O2/c1-10-15(17(22)23)20-21(14-8-6-13(19)7-9-14)16(10)11-2-4-12(18)5-3-11/h2-9H,1H3,(H,22,23)
InChIKeyYOCGFKLWNLDRBJ-UHFFFAOYSA-N
XLogP4.85
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500347.20
LogP ≤ 54.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxylic acid?
The IUPAC name of 1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxylic acid (CID 66641410) is 1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxylic acid.
What is the SMILES notation for 1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxylic acid?
The canonical SMILES for 1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxylic acid is Cc1c(C(=O)O)nn(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1.
What is the InChIKey of 1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxylic acid?
The InChIKey is YOCGFKLWNLDRBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl2N2O2/c1-10-15(17(22)23)20-21(14-8-6-13(19)7-9-14)16(10)11-2-4-12(18)5-3-11/h2-9H,1H3,(H,22,23).
What are the key properties of 1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxylic acid?
1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxylic acid has a molecular weight of 347.20 g/mol, XLogP of 4.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxylic acid is sourced from PubChem (CID 66641410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).