C29H32Cl2N4O — CID 166948771
N-[2-(2-adamantylamino)ethyl]-1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxamide (PubChem CID 166948771) has the molecular formula C29H32Cl2N4O and a molecular weight of 523.51 g/mol. Its IUPAC name is N-[2-(2-adamantylamino)ethyl]-1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | N-[2-(2-adamantylamino)ethyl]-1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 166948771 |
| Molecular Formula | C29H32Cl2N4O |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | N-[2-(2-adamantylamino)ethyl]-1,5-bis(4-chlorophenyl)-4-methylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCNC2C3CC4CC(C3)CC2C4)nn(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H32Cl2N4O/c1-17-26(29(36)33-11-10-32-27-21-13-18-12-19(15-21)16-22(27)14-18)34-35(25-8-6-24(31)7-9-25)28(17)20-2-4-23(30)5-3-20/h2-9,18-19,21-22,27,32H,10-16H2,1H3,(H,33,36) |
| InChIKey | KITSTUDWLXSNLC-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|