C29H30Cl4N4O — CID 162699751
N-[2-(2-adamantylamino)ethyl]-1,5-bis(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide (PubChem CID 162699751) has the molecular formula C29H30Cl4N4O and a molecular weight of 592.40 g/mol. Its IUPAC name is N-[2-(2-adamantylamino)ethyl]-1,5-bis(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | N-[2-(2-adamantylamino)ethyl]-1,5-bis(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 162699751 |
| Molecular Formula | C29H30Cl4N4O |
| Molecular Weight | 592.40 g/mol |
| Exact Mass | 590.12 |
| IUPAC Name | N-[2-(2-adamantylamino)ethyl]-1,5-bis(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCNC2C3CC4CC(C3)CC2C4)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C29H30Cl4N4O/c1-15-26(29(38)35-7-6-34-27-18-9-16-8-17(11-18)12-19(27)10-16)36-37(25-5-3-21(31)14-24(25)33)28(15)22-4-2-20(30)13-23(22)32/h2-5,13-14,16-19,27,34H,6-12H2,1H3,(H,35,38) |
| InChIKey | XLLYOWNXBHZLFW-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.40 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|