C28H38Cl2N6O — CID 162699783
N-[2-(2-adamantylamino)ethyl]-1-(2,4-dichlorophenyl)-4-methyl-5-(4-methylpiperazin-1-yl)pyrazole-3-carboxamide (PubChem CID 162699783) has the molecular formula C28H38Cl2N6O and a molecular weight of 545.56 g/mol. Its IUPAC name is N-[2-(2-adamantylamino)ethyl]-1-(2,4-dichlorophenyl)-4-methyl-5-(4-methylpiperazin-1-yl)pyrazole-3-carboxamide.
| Compound Name | N-[2-(2-adamantylamino)ethyl]-1-(2,4-dichlorophenyl)-4-methyl-5-(4-methylpiperazin-1-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 162699783 |
| Molecular Formula | C28H38Cl2N6O |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | N-[2-(2-adamantylamino)ethyl]-1-(2,4-dichlorophenyl)-4-methyl-5-(4-methylpiperazin-1-yl)pyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCNC2C3CC4CC(C3)CC2C4)nn(-c2ccc(Cl)cc2Cl)c1N1CCN(C)CC1 |
| InChI | InChI=1S/C28H38Cl2N6O/c1-17-25(27(37)32-6-5-31-26-20-12-18-11-19(14-20)15-21(26)13-18)33-36(24-4-3-22(29)16-23(24)30)28(17)35-9-7-34(2)8-10-35/h3-4,16,18-21,26,31H,5-15H2,1-2H3,(H,32,37) |
| InChIKey | SWZCTBHOMDQHFA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|