C24H17Cl3N4O2 — CID 137175244
5-(4-chlorophenyl)-1-(3,4-dichlorophenyl)-N-[(E)-(4-hydroxyphenyl)methylideneamino]-4-methylpyrazole-3-carboxamide (PubChem CID 137175244) has the molecular formula C24H17Cl3N4O2 and a molecular weight of 499.79 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(3,4-dichlorophenyl)-N-[(E)-(4-hydroxyphenyl)methylideneamino]-4-methylpyrazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-1-(3,4-dichlorophenyl)-N-[(E)-(4-hydroxyphenyl)methylideneamino]-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 137175244 |
| Molecular Formula | C24H17Cl3N4O2 |
| Molecular Weight | 499.79 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(3,4-dichlorophenyl)-N-[(E)-(4-hydroxyphenyl)methylideneamino]-4-methylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)N/N=C/c2ccc(O)cc2)nn(-c2ccc(Cl)c(Cl)c2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H17Cl3N4O2/c1-14-22(24(33)29-28-13-15-2-9-19(32)10-3-15)30-31(18-8-11-20(26)21(27)12-18)23(14)16-4-6-17(25)7-5-16/h2-13,32H,1H3,(H,29,33)/b28-13+ |
| InChIKey | PIVCNUADWHAWMK-XODNFHPESA-N |
| XLogP | 6.28 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.79 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|