C22H19ClN6O2 — CID 126066526
1-(4-chlorophenyl)-5-cyano-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-4-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 126066526) has the molecular formula C22H19ClN6O2 and a molecular weight of 434.89 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-cyano-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-4-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-5-cyano-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-4-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 126066526 |
| Molecular Formula | C22H19ClN6O2 |
| Molecular Weight | 434.89 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 1-(4-chlorophenyl)-5-cyano-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-4-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | Cc1c(C(=O)N/N=C/c2ccc(N(C)C)cc2)nn(-c2ccc(Cl)cc2)c(=O)c1C#N |
| InChI | InChI=1S/C22H19ClN6O2/c1-14-19(12-24)22(31)29(18-10-6-16(23)7-11-18)27-20(14)21(30)26-25-13-15-4-8-17(9-5-15)28(2)3/h4-11,13H,1-3H3,(H,26,30)/b25-13+ |
| InChIKey | TZEUIEUXQGEZRC-DHRITJCHSA-N |
| XLogP | 2.90 |
| TPSA | 103.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.89 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|